C36H30N2O6 — CID 10973948
benzhydryl (2R,3S)-2-[(3S,4R)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-3-hydroxybutanoate (PubChem CID 10973948) has the molecular formula C36H30N2O6 and a molecular weight of 586.64 g/mol. Its IUPAC name is benzhydryl (2R,3S)-2-[(3S,4R)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-3-hydroxybutanoate.
| Compound Name | benzhydryl (2R,3S)-2-[(3S,4R)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 10973948 |
| Molecular Formula | C36H30N2O6 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | benzhydryl (2R,3S)-2-[(3S,4R)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-[(E)-2-phenylethenyl]azetidin-1-yl]-3-hydroxybutanoate |
| SMILES | C[C@H](O)[C@H](C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)[C@@H](N2C(=O)c3ccccc3C2=O)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C36H30N2O6/c1-23(39)30(36(43)44-32(25-15-7-3-8-16-25)26-17-9-4-10-18-26)37-29(22-21-24-13-5-2-6-14-24)31(35(37)42)38-33(40)27-19-11-12-20-28(27)34(38)41/h2-23,29-32,39H,1H3/b22-21+/t23-,29+,30+,31-/m0/s1 |
| InChIKey | GQIQWRFIDCLCSP-VAIGOIEISA-N |
| XLogP | 4.66 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|