C26H20N2O3 — CID 11441181
2-[(3S,4R)-1-(3-methylphenyl)-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl]isoindole-1,3-dione (PubChem CID 11441181) has the molecular formula C26H20N2O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-[(3S,4R)-1-(3-methylphenyl)-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3S,4R)-1-(3-methylphenyl)-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11441181 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[(3S,4R)-1-(3-methylphenyl)-2-oxo-4-[(E)-2-phenylethenyl]azetidin-3-yl]isoindole-1,3-dione |
| SMILES | Cc1cccc(N2C(=O)[C@@H](N3C(=O)c4ccccc4C3=O)[C@H]2/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C26H20N2O3/c1-17-8-7-11-19(16-17)27-22(15-14-18-9-3-2-4-10-18)23(26(27)31)28-24(29)20-12-5-6-13-21(20)25(28)30/h2-16,22-23H,1H3/b15-14+/t22-,23+/m1/s1 |
| InChIKey | VIECVKSJTFRWNU-WBWJIJALSA-N |
| XLogP | 4.09 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|