C28H24N2O5 — CID 70390446
2-[1-[(2,4-dimethoxyphenyl)methyl]-2-oxo-4-[(Z)-2-phenylethenyl]azetidin-3-yl]isoindole-1,3-dione (PubChem CID 70390446) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-[1-[(2,4-dimethoxyphenyl)methyl]-2-oxo-4-[(Z)-2-phenylethenyl]azetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[(2,4-dimethoxyphenyl)methyl]-2-oxo-4-[(Z)-2-phenylethenyl]azetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70390446 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-[1-[(2,4-dimethoxyphenyl)methyl]-2-oxo-4-[(Z)-2-phenylethenyl]azetidin-3-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)C(N3C(=O)c4ccccc4C3=O)C2/C=C\c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C28H24N2O5/c1-34-20-14-13-19(24(16-20)35-2)17-29-23(15-12-18-8-4-3-5-9-18)25(28(29)33)30-26(31)21-10-6-7-11-22(21)27(30)32/h3-16,23,25H,17H2,1-2H3/b15-12- |
| InChIKey | OTBDVQWKDNRVSX-QINSGFPZSA-N |
| XLogP | 3.79 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|