C28H28N2O7 — CID 56615866
diethyl (2S)-2-[(3R,4S)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-(2-phenylethenyl)azetidin-1-yl]pentanedioate (PubChem CID 56615866) has the molecular formula C28H28N2O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is diethyl (2S)-2-[(3R,4S)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-(2-phenylethenyl)azetidin-1-yl]pentanedioate.
| Compound Name | diethyl (2S)-2-[(3R,4S)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-(2-phenylethenyl)azetidin-1-yl]pentanedioate |
|---|---|
| PubChem CID | 56615866 |
| Molecular Formula | C28H28N2O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | diethyl (2S)-2-[(3R,4S)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-(2-phenylethenyl)azetidin-1-yl]pentanedioate |
| SMILES | CCOC(=O)CC[C@@H](C(=O)OCC)N1C(=O)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H]1C=Cc1ccccc1 |
| InChI | InChI=1S/C28H28N2O7/c1-3-36-23(31)17-16-22(28(35)37-4-2)29-21(15-14-18-10-6-5-7-11-18)24(27(29)34)30-25(32)19-12-8-9-13-20(19)26(30)33/h5-15,21-22,24H,3-4,16-17H2,1-2H3/t21-,22-,24+/m0/s1 |
| InChIKey | HWUCXGCYVBJCFF-WPFOTENUSA-N |
| XLogP | 2.85 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|