C30H25N3O8 — CID 67798773
benzyl (3R)-3-hydroxy-2-[3-(5-nitro-1,3-dioxoisoindol-2-yl)-2-oxo-4-(2-phenylethenyl)azetidin-1-yl]butanoate (PubChem CID 67798773) has the molecular formula C30H25N3O8 and a molecular weight of 555.54 g/mol. Its IUPAC name is benzyl (3R)-3-hydroxy-2-[3-(5-nitro-1,3-dioxoisoindol-2-yl)-2-oxo-4-(2-phenylethenyl)azetidin-1-yl]butanoate.
| Compound Name | benzyl (3R)-3-hydroxy-2-[3-(5-nitro-1,3-dioxoisoindol-2-yl)-2-oxo-4-(2-phenylethenyl)azetidin-1-yl]butanoate |
|---|---|
| PubChem CID | 67798773 |
| Molecular Formula | C30H25N3O8 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | benzyl (3R)-3-hydroxy-2-[3-(5-nitro-1,3-dioxoisoindol-2-yl)-2-oxo-4-(2-phenylethenyl)azetidin-1-yl]butanoate |
| SMILES | C[C@@H](O)C(C(=O)OCc1ccccc1)N1C(=O)C(N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)C1C=Cc1ccccc1 |
| InChI | InChI=1S/C30H25N3O8/c1-18(34)25(30(38)41-17-20-10-6-3-7-11-20)31-24(15-12-19-8-4-2-5-9-19)26(29(31)37)32-27(35)22-14-13-21(33(39)40)16-23(22)28(32)36/h2-16,18,24-26,34H,17H2,1H3/t18-,24?,25?,26?/m1/s1 |
| InChIKey | JGJSSUHSXDUKFY-HWANQDJQSA-N |
| XLogP | 2.98 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|