C24H19NO4S — CID 135056243
benzhydryl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-sulfanylpropanoate (PubChem CID 135056243) has the molecular formula C24H19NO4S and a molecular weight of 417.49 g/mol. Its IUPAC name is benzhydryl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-sulfanylpropanoate.
| Compound Name | benzhydryl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 135056243 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | benzhydryl (2R)-2-(1,3-dioxoisoindol-2-yl)-3-sulfanylpropanoate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)[C@H](CS)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H19NO4S/c26-22-18-13-7-8-14-19(18)23(27)25(22)20(15-30)24(28)29-21(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,20-21,30H,15H2/t20-/m0/s1 |
| InChIKey | PZLFDBFZJNSUCZ-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|