C26H19ClN2O5 — CID 57211780
benzhydryl 2-(3-chloro-2,5-dihydro-1,2-oxazol-5-yl)-2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 57211780) has the molecular formula C26H19ClN2O5 and a molecular weight of 474.90 g/mol. Its IUPAC name is benzhydryl 2-(3-chloro-2,5-dihydro-1,2-oxazol-5-yl)-2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | benzhydryl 2-(3-chloro-2,5-dihydro-1,2-oxazol-5-yl)-2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 57211780 |
| Molecular Formula | C26H19ClN2O5 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | benzhydryl 2-(3-chloro-2,5-dihydro-1,2-oxazol-5-yl)-2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C(C1C=C(Cl)NO1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H19ClN2O5/c27-21-15-20(34-28-21)22(29-24(30)18-13-7-8-14-19(18)25(29)31)26(32)33-23(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15,20,22-23,28H |
| InChIKey | GEMHONQXQAQTRU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|