C31H21NO9 — CID 14100516
4-[(1S)-2-benzhydryloxy-1-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethyl]phthalic acid (PubChem CID 14100516) has the molecular formula C31H21NO9 and a molecular weight of 551.51 g/mol. Its IUPAC name is 4-[(1S)-2-benzhydryloxy-1-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethyl]phthalic acid.
| Compound Name | 4-[(1S)-2-benzhydryloxy-1-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethyl]phthalic acid |
|---|---|
| PubChem CID | 14100516 |
| Molecular Formula | C31H21NO9 |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 4-[(1S)-2-benzhydryloxy-1-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethyl]phthalic acid |
| SMILES | O=C(O)c1ccc([C@H](ON2C(=O)c3ccccc3C2=O)C(=O)OC(c2ccccc2)c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C31H21NO9/c33-27-21-13-7-8-14-22(21)28(34)32(27)41-26(20-15-16-23(29(35)36)24(17-20)30(37)38)31(39)40-25(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17,25-26H,(H,35,36)(H,37,38)/t26-/m0/s1 |
| InChIKey | WQHYKPADFXXAFS-SANMLTNESA-N |
| XLogP | 4.68 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|