C29H27NO5S — CID 11103114
benzhydryl (2S,2'S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-2'-phenylspiro[4λ6-thia-1-azabicyclo[3.2.0]heptane-6,1'-cyclopropane]-2-carboxylate (PubChem CID 11103114) has the molecular formula C29H27NO5S and a molecular weight of 501.60 g/mol. Its IUPAC name is benzhydryl (2S,2'S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-2'-phenylspiro[4λ6-thia-1-azabicyclo[3.2.0]heptane-6,1'-cyclopropane]-2-carboxylate.
| Compound Name | benzhydryl (2S,2'S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-2'-phenylspiro[4λ6-thia-1-azabicyclo[3.2.0]heptane-6,1'-cyclopropane]-2-carboxylate |
|---|---|
| PubChem CID | 11103114 |
| Molecular Formula | C29H27NO5S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | benzhydryl (2S,2'S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-2'-phenylspiro[4λ6-thia-1-azabicyclo[3.2.0]heptane-6,1'-cyclopropane]-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@]3(C[C@H]3c3ccccc3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C29H27NO5S/c1-28(2)24(25(31)35-23(20-14-8-4-9-15-20)21-16-10-5-11-17-21)30-26(32)29(27(30)36(28,33)34)18-22(29)19-12-6-3-7-13-19/h3-17,22-24,27H,18H2,1-2H3/t22-,24-,27+,29-/m0/s1 |
| InChIKey | QEEHFTJSPQGAEW-PABBBREUSA-N |
| XLogP | 4.24 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |