C26H27NO6S — CID 10184391
benzhydryl (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-2'-prop-2-enoxyspiro[4λ6-thia-1-azabicyclo[3.2.0]heptane-6,1'-cyclopropane]-2-carboxylate (PubChem CID 10184391) has the molecular formula C26H27NO6S and a molecular weight of 481.57 g/mol. Its IUPAC name is benzhydryl (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-2'-prop-2-enoxyspiro[4λ6-thia-1-azabicyclo[3.2.0]heptane-6,1'-cyclopropane]-2-carboxylate.
| Compound Name | benzhydryl (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-2'-prop-2-enoxyspiro[4λ6-thia-1-azabicyclo[3.2.0]heptane-6,1'-cyclopropane]-2-carboxylate |
|---|---|
| PubChem CID | 10184391 |
| Molecular Formula | C26H27NO6S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | benzhydryl (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-2'-prop-2-enoxyspiro[4λ6-thia-1-azabicyclo[3.2.0]heptane-6,1'-cyclopropane]-2-carboxylate |
| SMILES | C=CCOC1C[C@]12C(=O)N1[C@@H](C(=O)OC(c3ccccc3)c3ccccc3)C(C)(C)S(=O)(=O)[C@@H]12 |
| InChI | InChI=1S/C26H27NO6S/c1-4-15-32-19-16-26(19)23(29)27-21(25(2,3)34(30,31)24(26)27)22(28)33-20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h4-14,19-21,24H,1,15-16H2,2-3H3/t19?,21-,24+,26+/m0/s1 |
| InChIKey | DXCCCOTUUSUZOT-ZEFRWHJUSA-N |
| XLogP | 3.02 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|