C21H19BrINO5S — CID 11039312
benzhydryl (2S,5R,6R)-6-bromo-6-iodo-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 11039312) has the molecular formula C21H19BrINO5S and a molecular weight of 604.26 g/mol. Its IUPAC name is benzhydryl (2S,5R,6R)-6-bromo-6-iodo-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,5R,6R)-6-bromo-6-iodo-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11039312 |
| Molecular Formula | C21H19BrINO5S |
| Molecular Weight | 604.26 g/mol |
| Exact Mass | 602.92 |
| IUPAC Name | benzhydryl (2S,5R,6R)-6-bromo-6-iodo-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@](Br)(I)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C21H19BrINO5S/c1-20(2)16(24-18(26)21(22,23)19(24)30(20,27)28)17(25)29-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16,19H,1-2H3/t16-,19+,21+/m0/s1 |
| InChIKey | ZYNRDXYNHIWJAS-LDQXTDLNSA-N |
| XLogP | 3.59 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|