C26H29BrINO5S — CID 10995998
benzhydryl (2S,5R,6R)-6-bromo-6-[(2S)-2-iodo-3,3-dimethoxypropyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 10995998) has the molecular formula C26H29BrINO5S and a molecular weight of 674.40 g/mol. Its IUPAC name is benzhydryl (2S,5R,6R)-6-bromo-6-[(2S)-2-iodo-3,3-dimethoxypropyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,5R,6R)-6-bromo-6-[(2S)-2-iodo-3,3-dimethoxypropyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10995998 |
| Molecular Formula | C26H29BrINO5S |
| Molecular Weight | 674.40 g/mol |
| Exact Mass | 673.00 |
| IUPAC Name | benzhydryl (2S,5R,6R)-6-bromo-6-[(2S)-2-iodo-3,3-dimethoxypropyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(OC)[C@@H](I)C[C@@]1(Br)C(=O)N2[C@@H](C(=O)OC(c3ccccc3)c3ccccc3)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C26H29BrINO5S/c1-25(2)20(29-23(31)26(27,24(29)35-25)15-18(28)22(32-3)33-4)21(30)34-19(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,18-20,22,24H,15H2,1-4H3/t18-,20-,24+,26+/m0/s1 |
| InChIKey | OSSHTJDYMGLORU-DCCOOJGFSA-N |
| XLogP | 5.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|