C51H41N3O7S — CID 164619689
tribenzhydryl (2S,5R)-3,3-dimethyl-7-oxospiro[4-thia-1-azabicyclo[3.2.0]heptane-6,5'-pyrazole]-2,3',4'-tricarboxylate (PubChem CID 164619689) has the molecular formula C51H41N3O7S and a molecular weight of 839.97 g/mol. Its IUPAC name is tribenzhydryl (2S,5R)-3,3-dimethyl-7-oxospiro[4-thia-1-azabicyclo[3.2.0]heptane-6,5'-pyrazole]-2,3',4'-tricarboxylate.
| Compound Name | tribenzhydryl (2S,5R)-3,3-dimethyl-7-oxospiro[4-thia-1-azabicyclo[3.2.0]heptane-6,5'-pyrazole]-2,3',4'-tricarboxylate |
|---|---|
| PubChem CID | 164619689 |
| Molecular Formula | C51H41N3O7S |
| Molecular Weight | 839.97 g/mol |
| Exact Mass | 839.27 |
| IUPAC Name | tribenzhydryl (2S,5R)-3,3-dimethyl-7-oxospiro[4-thia-1-azabicyclo[3.2.0]heptane-6,5'-pyrazole]-2,3',4'-tricarboxylate |
| SMILES | CC1(C)S[C@H]2N(C(=O)C23N=NC(C(=O)OC(c2ccccc2)c2ccccc2)=C3C(=O)OC(c2ccccc2)c2ccccc2)[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H41N3O7S/c1-50(2)44(47(57)61-43(37-29-17-7-18-30-37)38-31-19-8-20-32-38)54-48(58)51(49(54)62-50)39(45(55)59-41(33-21-9-3-10-22-33)34-23-11-4-12-24-34)40(52-53-51)46(56)60-42(35-25-13-5-14-26-35)36-27-15-6-16-28-36/h3-32,41-44,49H,1-2H3/t44-,49+,51?/m0/s1 |
| InChIKey | IFLPDNIITMYJBC-JPPGUVCOSA-N |
| XLogP | 9.51 |
| TPSA | 123.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.97 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|