C40H35NO6S — CID 102101021
2-O-benzhydryl 1-O'-benzyl (2S,4'S,5R,6S)-4'-benzoyl-3,3-dimethyl-7-oxospiro[4-thia-1-azabicyclo[3.2.0]heptane-6,5'-cyclopentene]-1',2-dicarboxylate (PubChem CID 102101021) has the molecular formula C40H35NO6S and a molecular weight of 657.79 g/mol. Its IUPAC name is 2-O-benzhydryl 1-O'-benzyl (2S,4'S,5R,6S)-4'-benzoyl-3,3-dimethyl-7-oxospiro[4-thia-1-azabicyclo[3.2.0]heptane-6,5'-cyclopentene]-1',2-dicarboxylate.
| Compound Name | 2-O-benzhydryl 1-O'-benzyl (2S,4'S,5R,6S)-4'-benzoyl-3,3-dimethyl-7-oxospiro[4-thia-1-azabicyclo[3.2.0]heptane-6,5'-cyclopentene]-1',2-dicarboxylate |
|---|---|
| PubChem CID | 102101021 |
| Molecular Formula | C40H35NO6S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.22 |
| IUPAC Name | 2-O-benzhydryl 1-O'-benzyl (2S,4'S,5R,6S)-4'-benzoyl-3,3-dimethyl-7-oxospiro[4-thia-1-azabicyclo[3.2.0]heptane-6,5'-cyclopentene]-1',2-dicarboxylate |
| SMILES | CC1(C)S[C@H]2N(C(=O)[C@]23C(C(=O)OCc2ccccc2)=CC[C@@H]3C(=O)c2ccccc2)[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H35NO6S/c1-39(2)34(36(44)47-33(28-19-11-5-12-20-28)29-21-13-6-14-22-29)41-37(45)40(38(41)48-39)30(32(42)27-17-9-4-10-18-27)23-24-31(40)35(43)46-25-26-15-7-3-8-16-26/h3-22,24,30,33-34,38H,23,25H2,1-2H3/t30-,34+,38-,40+/m1/s1 |
| InChIKey | MCSMGSYSTNWFEM-NQPYCKSISA-N |
| XLogP | 6.94 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |