C31H27NO5S — CID 10324566
benzhydryl (2S,5R,6S)-6-ethynyl-6-(4-methoxybenzoyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 10324566) has the molecular formula C31H27NO5S and a molecular weight of 525.63 g/mol. Its IUPAC name is benzhydryl (2S,5R,6S)-6-ethynyl-6-(4-methoxybenzoyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,5R,6S)-6-ethynyl-6-(4-methoxybenzoyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10324566 |
| Molecular Formula | C31H27NO5S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | benzhydryl (2S,5R,6S)-6-ethynyl-6-(4-methoxybenzoyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C#C[C@]1(C(=O)c2ccc(OC)cc2)C(=O)N2[C@@H](C(=O)OC(c3ccccc3)c3ccccc3)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C31H27NO5S/c1-5-31(26(33)22-16-18-23(36-4)19-17-22)28(35)32-25(30(2,3)38-29(31)32)27(34)37-24(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h1,6-19,24-25,29H,2-4H3/t25-,29+,31-/m0/s1 |
| InChIKey | DKMZHVAOEDUXRQ-MFCLUPKDSA-N |
| XLogP | 4.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|