C29H26N2O4 — CID 12911988
benzhydryl (2R)-2-[(1R,5S)-3-benzyl-7-oxo-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]-3-methylbut-3-enoate (PubChem CID 12911988) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is benzhydryl (2R)-2-[(1R,5S)-3-benzyl-7-oxo-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]-3-methylbut-3-enoate.
| Compound Name | benzhydryl (2R)-2-[(1R,5S)-3-benzyl-7-oxo-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 12911988 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | benzhydryl (2R)-2-[(1R,5S)-3-benzyl-7-oxo-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)[C@H](C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)[C@@H]2N=C(Cc3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C29H26N2O4/c1-19(2)25(29(33)35-26(21-14-8-4-9-15-21)22-16-10-5-11-17-22)31-27(32)24-28(31)34-23(30-24)18-20-12-6-3-7-13-20/h3-17,24-26,28H,1,18H2,2H3/t24-,25+,28-/m0/s1 |
| InChIKey | YSOWQLCYIGLSOP-OARDWFSCSA-N |
| XLogP | 4.47 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|