About methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate
methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate (PubChem CID 171989647) has the molecular formula C17H18N2O5S2
and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate |
| PubChem CID | 171989647 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)N1C(=O)C(N2C(=O)c3ccccc3C2=O)C1(SC)SC |
| InChI | InChI=1S/C17H18N2O5S2/c1-9(16(23)24-2)19-15(22)12(17(19,25-3)26-4)18-13(20)10-7-5-6-8-11(10)14(18)21/h5-9,12H,1-4H3/t9-,12?/m1/s1 |
| InChIKey | AXIUNKFMWPFCGA-PKEIRNPWSA-N |
| XLogP | 1.43 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate?
The IUPAC name of methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate (CID 171989647) is methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate.
What is the SMILES notation for methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate?
The canonical SMILES for methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate is COC(=O)[C@@H](C)N1C(=O)C(N2C(=O)c3ccccc3C2=O)C1(SC)SC.
What is the InChIKey of methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate?
The InChIKey is AXIUNKFMWPFCGA-PKEIRNPWSA-N. The full InChI is InChI=1S/C17H18N2O5S2/c1-9(16(23)24-2)19-15(22)12(17(19,25-3)26-4)18-13(20)10-7-5-6-8-11(10)14(18)21/h5-9,12H,1-4H3/t9-,12?/m1/s1.
What are the key properties of methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate?
methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate has a molecular weight of 394.47 g/mol, XLogP of 1.43, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[3-(1,3-dioxoisoindol-2-yl)-2,2-bis(methylsulfanyl)-4-oxoazetidin-1-yl]propanoate is sourced from PubChem (CID 171989647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).