C23H21N3O6 — CID 25138472
methyl (2S)-2-[(3R,4aS,9aR)-3-(1,3-dioxoisoindol-2-yl)-4a-hydroxy-2-oxo-3,4,9,9a-tetrahydropyrido[2,3-b]indol-1-yl]propanoate (PubChem CID 25138472) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is methyl (2S)-2-[(3R,4aS,9aR)-3-(1,3-dioxoisoindol-2-yl)-4a-hydroxy-2-oxo-3,4,9,9a-tetrahydropyrido[2,3-b]indol-1-yl]propanoate.
| Compound Name | methyl (2S)-2-[(3R,4aS,9aR)-3-(1,3-dioxoisoindol-2-yl)-4a-hydroxy-2-oxo-3,4,9,9a-tetrahydropyrido[2,3-b]indol-1-yl]propanoate |
|---|---|
| PubChem CID | 25138472 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | methyl (2S)-2-[(3R,4aS,9aR)-3-(1,3-dioxoisoindol-2-yl)-4a-hydroxy-2-oxo-3,4,9,9a-tetrahydropyrido[2,3-b]indol-1-yl]propanoate |
| SMILES | COC(=O)[C@H](C)N1C(=O)[C@H](N2C(=O)c3ccccc3C2=O)C[C@]2(O)c3ccccc3N[C@H]12 |
| InChI | InChI=1S/C23H21N3O6/c1-12(21(30)32-2)25-20(29)17(26-18(27)13-7-3-4-8-14(13)19(26)28)11-23(31)15-9-5-6-10-16(15)24-22(23)25/h3-10,12,17,22,24,31H,11H2,1-2H3/t12-,17+,22+,23-/m0/s1 |
| InChIKey | HRQYMEUAPYRLGH-OJVGWFQVSA-N |
| XLogP | 1.08 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|