C21H18N4O3 — CID 11337798
(1S,4S,7S,9R)-9-hydroxy-4-(1H-indol-3-yl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 11337798) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is (1S,4S,7S,9R)-9-hydroxy-4-(1H-indol-3-yl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1S,4S,7S,9R)-9-hydroxy-4-(1H-indol-3-yl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 11337798 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (1S,4S,7S,9R)-9-hydroxy-4-(1H-indol-3-yl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | O=C1N[C@@H](c2c[nH]c3ccccc23)C(=O)N2[C@H]1C[C@@]1(O)c3ccccc3N[C@@H]21 |
| InChI | InChI=1S/C21H18N4O3/c26-18-16-9-21(28)13-6-2-4-8-15(13)23-20(21)25(16)19(27)17(24-18)12-10-22-14-7-3-1-5-11(12)14/h1-8,10,16-17,20,22-23,28H,9H2,(H,24,26)/t16-,17-,20-,21+/m0/s1 |
| InChIKey | WYYDEGPBVINZHT-IDPBPBMLSA-N |
| XLogP | 1.58 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |