C22H20N4O2S2 — CID 144641295
(9S)-7-(disulfanyl)-9-(1H-indol-3-yl)-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 144641295) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is (9S)-7-(disulfanyl)-9-(1H-indol-3-yl)-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (9S)-7-(disulfanyl)-9-(1H-indol-3-yl)-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 144641295 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (9S)-7-(disulfanyl)-9-(1H-indol-3-yl)-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | CN1CC(=O)N2C3Nc4ccccc4[C@@]3(c3c[nH]c4ccccc34)CC2(SS)C1=O |
| InChI | InChI=1S/C22H20N4O2S2/c1-25-11-18(27)26-19-21(12-22(26,30-29)20(25)28,14-7-3-5-9-17(14)24-19)15-10-23-16-8-4-2-6-13(15)16/h2-10,19,23-24,29H,11-12H2,1H3/t19?,21-,22?/m1/s1 |
| InChIKey | NXYNXBPPDXJBLZ-NJEKYYFSSA-N |
| XLogP | 3.18 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|