C26H24N4O5 — CID 139116280
ethyl acetate;(1R,9S)-9-(1H-indol-3-yl)-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-7,10,12,14-tetraene-3,4,6-trione (PubChem CID 139116280) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is ethyl acetate;(1R,9S)-9-(1H-indol-3-yl)-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-7,10,12,14-tetraene-3,4,6-trione.
| Compound Name | ethyl acetate;(1R,9S)-9-(1H-indol-3-yl)-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-7,10,12,14-tetraene-3,4,6-trione |
|---|---|
| PubChem CID | 139116280 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | ethyl acetate;(1R,9S)-9-(1H-indol-3-yl)-5-methyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-7,10,12,14-tetraene-3,4,6-trione |
| SMILES | CCOC(C)=O.CN1C(=O)C(=O)N2C(=C[C@]3(c4c[nH]c5ccccc45)c4ccccc4N[C@H]23)C1=O |
| InChI | InChI=1S/C22H16N4O3.C4H8O2/c1-25-18(27)17-10-22(14-11-23-15-8-4-2-6-12(14)15)13-7-3-5-9-16(13)24-21(22)26(17)20(29)19(25)28;1-3-6-4(2)5/h2-11,21,23-24H,1H3;3H2,1-2H3/t21-,22-;/m1./s1 |
| InChIKey | JCQGPRQRRBEHRV-HLUKFBSCSA-N |
| XLogP | 2.50 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|