C24H27N3O3 — CID 132524780
ethyl 2-(ethylamino)-3-[(3S)-3-(1H-indol-3-yl)-1-methyl-2-oxoindol-3-yl]propanoate (PubChem CID 132524780) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is ethyl 2-(ethylamino)-3-[(3S)-3-(1H-indol-3-yl)-1-methyl-2-oxoindol-3-yl]propanoate.
| Compound Name | ethyl 2-(ethylamino)-3-[(3S)-3-(1H-indol-3-yl)-1-methyl-2-oxoindol-3-yl]propanoate |
|---|---|
| PubChem CID | 132524780 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | ethyl 2-(ethylamino)-3-[(3S)-3-(1H-indol-3-yl)-1-methyl-2-oxoindol-3-yl]propanoate |
| SMILES | CCNC(C[C@@]1(c2c[nH]c3ccccc23)C(=O)N(C)c2ccccc21)C(=O)OCC |
| InChI | InChI=1S/C24H27N3O3/c1-4-25-20(22(28)30-5-2)14-24(18-15-26-19-12-8-6-10-16(18)19)17-11-7-9-13-21(17)27(3)23(24)29/h6-13,15,20,25-26H,4-5,14H2,1-3H3/t20?,24-/m1/s1 |
| InChIKey | JKOGNNPRDUUFNR-PIFIWZBESA-N |
| XLogP | 3.36 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |