C20H18N2O4 — CID 134842021
ethyl (3R)-3-(1H-indol-3-yl)-5-methyl-2-oxo-4H-1,4-benzoxazine-3-carboxylate (PubChem CID 134842021) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is ethyl (3R)-3-(1H-indol-3-yl)-5-methyl-2-oxo-4H-1,4-benzoxazine-3-carboxylate.
| Compound Name | ethyl (3R)-3-(1H-indol-3-yl)-5-methyl-2-oxo-4H-1,4-benzoxazine-3-carboxylate |
|---|---|
| PubChem CID | 134842021 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | ethyl (3R)-3-(1H-indol-3-yl)-5-methyl-2-oxo-4H-1,4-benzoxazine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(c2c[nH]c3ccccc23)Nc2c(C)cccc2OC1=O |
| InChI | InChI=1S/C20H18N2O4/c1-3-25-18(23)20(14-11-21-15-9-5-4-8-13(14)15)19(24)26-16-10-6-7-12(2)17(16)22-20/h4-11,21-22H,3H2,1-2H3/t20-/m1/s1 |
| InChIKey | GCNMQEYHLLGZRF-HXUWFJFHSA-N |
| XLogP | 3.27 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|