C29H22N4O3S2 — CID 90264288
(11R,14R)-3-(1H-indol-3-yl)-19-methyl-10-phenyl-15,17-dithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,16,18-trione (PubChem CID 90264288) has the molecular formula C29H22N4O3S2 and a molecular weight of 538.65 g/mol. Its IUPAC name is (11R,14R)-3-(1H-indol-3-yl)-19-methyl-10-phenyl-15,17-dithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,16,18-trione.
| Compound Name | (11R,14R)-3-(1H-indol-3-yl)-19-methyl-10-phenyl-15,17-dithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,16,18-trione |
|---|---|
| PubChem CID | 90264288 |
| Molecular Formula | C29H22N4O3S2 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | (11R,14R)-3-(1H-indol-3-yl)-19-methyl-10-phenyl-15,17-dithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,16,18-trione |
| SMILES | CN1C(=O)C23CC4(c5c[nH]c6ccccc56)c5ccccc5N(c5ccccc5)[C@@H]4N2C(=O)[C@H]1SC(=O)S3 |
| InChI | InChI=1S/C29H22N4O3S2/c1-31-24-23(34)33-25-28(16-29(33,26(31)35)38-27(36)37-24,20-15-30-21-13-7-5-11-18(20)21)19-12-6-8-14-22(19)32(25)17-9-3-2-4-10-17/h2-15,24-25,30H,16H2,1H3/t24-,25-,28?,29?/m1/s1 |
| InChIKey | VPAILWWJHMRSLO-BVSWHAQMSA-N |
| XLogP | 5.26 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|