C23H20N4O3S3 — CID 11504208
(1S,2S,3R,11R,14R)-2-hydroxy-3-(1H-indol-3-yl)-14,19-dimethyl-15,16,17-trithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,18-dione (PubChem CID 11504208) has the molecular formula C23H20N4O3S3 and a molecular weight of 496.64 g/mol. Its IUPAC name is (1S,2S,3R,11R,14R)-2-hydroxy-3-(1H-indol-3-yl)-14,19-dimethyl-15,16,17-trithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,18-dione.
| Compound Name | (1S,2S,3R,11R,14R)-2-hydroxy-3-(1H-indol-3-yl)-14,19-dimethyl-15,16,17-trithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,18-dione |
|---|---|
| PubChem CID | 11504208 |
| Molecular Formula | C23H20N4O3S3 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | (1S,2S,3R,11R,14R)-2-hydroxy-3-(1H-indol-3-yl)-14,19-dimethyl-15,16,17-trithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,18-dione |
| SMILES | CN1C(=O)[C@]23SSS[C@]1(C)C(=O)N2[C@H]1Nc2ccccc2[C@@]1(c1c[nH]c2ccccc12)[C@@H]3O |
| InChI | InChI=1S/C23H20N4O3S3/c1-21-19(29)27-18-22(13-8-4-6-10-16(13)25-18,14-11-24-15-9-5-3-7-12(14)15)17(28)23(27,32-33-31-21)20(30)26(21)2/h3-11,17-18,24-25,28H,1-2H3/t17-,18+,21+,22+,23-/m0/s1 |
| InChIKey | FIIJQUIYIBLWOG-HMKLVTIHSA-N |
| XLogP | 3.34 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|