C25H24N2O5 — CID 102530966
methyl 2-(1,3-dioxoisoindol-2-yl)-3-[4-(3-methylbut-2-enyl)-2-oxo-1,3-dihydroindol-3-yl]propanoate (PubChem CID 102530966) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-3-[4-(3-methylbut-2-enyl)-2-oxo-1,3-dihydroindol-3-yl]propanoate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)-3-[4-(3-methylbut-2-enyl)-2-oxo-1,3-dihydroindol-3-yl]propanoate |
|---|---|
| PubChem CID | 102530966 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)-3-[4-(3-methylbut-2-enyl)-2-oxo-1,3-dihydroindol-3-yl]propanoate |
| SMILES | COC(=O)C(CC1C(=O)Nc2cccc(CC=C(C)C)c21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H24N2O5/c1-14(2)11-12-15-7-6-10-19-21(15)18(22(28)26-19)13-20(25(31)32-3)27-23(29)16-8-4-5-9-17(16)24(27)30/h4-11,18,20H,12-13H2,1-3H3,(H,26,28) |
| InChIKey | CFNJGVBJPXPSSP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|