C26H20N2O5 — CID 102412348
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[(3R)-2-oxo-3-phenyl-1H-indol-3-yl]propanoate (PubChem CID 102412348) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[(3R)-2-oxo-3-phenyl-1H-indol-3-yl]propanoate.
| Compound Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[(3R)-2-oxo-3-phenyl-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 102412348 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[(3R)-2-oxo-3-phenyl-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)[C@H](C[C@]1(c2ccccc2)C(=O)Nc2ccccc21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H20N2O5/c1-33-24(31)21(28-22(29)17-11-5-6-12-18(17)23(28)30)15-26(16-9-3-2-4-10-16)19-13-7-8-14-20(19)27-25(26)32/h2-14,21H,15H2,1H3,(H,27,32)/t21-,26+/m0/s1 |
| InChIKey | KNQJTQDGZRZEAD-HFZDXXHNSA-N |
| XLogP | 3.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|