C28H23NO5S2 — CID 102053540
(3R)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-phenyl-1H-indol-2-one (PubChem CID 102053540) has the molecular formula C28H23NO5S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is (3R)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-phenyl-1H-indol-2-one.
| Compound Name | (3R)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-phenyl-1H-indol-2-one |
|---|---|
| PubChem CID | 102053540 |
| Molecular Formula | C28H23NO5S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | (3R)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-phenyl-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2[C@@]1(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23NO5S2/c30-27-28(21-12-4-1-5-13-21,24-18-10-11-19-25(24)29-27)20-26(35(31,32)22-14-6-2-7-15-22)36(33,34)23-16-8-3-9-17-23/h1-19,26H,20H2,(H,29,30)/t28-/m1/s1 |
| InChIKey | QTRYMRVEMJZNCD-MUUNZHRXSA-N |
| XLogP | 4.59 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |