C23H20O6S2 — CID 57387250
(3S)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-methyl-1-benzofuran-2-one (PubChem CID 57387250) has the molecular formula C23H20O6S2 and a molecular weight of 456.54 g/mol. Its IUPAC name is (3S)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-methyl-1-benzofuran-2-one.
| Compound Name | (3S)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-methyl-1-benzofuran-2-one |
|---|---|
| PubChem CID | 57387250 |
| Molecular Formula | C23H20O6S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | (3S)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-methyl-1-benzofuran-2-one |
| SMILES | C[C@@]1(CC(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)C(=O)Oc2ccccc21 |
| InChI | InChI=1S/C23H20O6S2/c1-23(19-14-8-9-15-20(19)29-22(23)24)16-21(30(25,26)17-10-4-2-5-11-17)31(27,28)18-12-6-3-7-13-18/h2-15,21H,16H2,1H3/t23-/m0/s1 |
| InChIKey | NVNSMFDDZNKPRY-QHCPKHFHSA-N |
| XLogP | 3.53 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|