C33H31N3O4 — CID 11706453
methyl 2-[[(2S,3aR,8bS)-8b-hydroxy-3-trityl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]acetate (PubChem CID 11706453) has the molecular formula C33H31N3O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is methyl 2-[[(2S,3aR,8bS)-8b-hydroxy-3-trityl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[(2S,3aR,8bS)-8b-hydroxy-3-trityl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 11706453 |
| Molecular Formula | C33H31N3O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | methyl 2-[[(2S,3aR,8bS)-8b-hydroxy-3-trityl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@@H]1C[C@]2(O)c3ccccc3N[C@@H]2N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31N3O4/c1-40-29(37)22-34-30(38)28-21-32(39)26-19-11-12-20-27(26)35-31(32)36(28)33(23-13-5-2-6-14-23,24-15-7-3-8-16-24)25-17-9-4-10-18-25/h2-20,28,31,35,39H,21-22H2,1H3,(H,34,38)/t28-,31+,32-/m0/s1 |
| InChIKey | LAMQDSCYIWBJJS-YXQUNVLPSA-N |
| XLogP | 3.98 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|