C25H25ClN6O4S — CID 70455912
benzyl 2-[3-(2-amino-2-oxo-1-phenylethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate (PubChem CID 70455912) has the molecular formula C25H25ClN6O4S and a molecular weight of 541.03 g/mol. Its IUPAC name is benzyl 2-[3-(2-amino-2-oxo-1-phenylethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate.
| Compound Name | benzyl 2-[3-(2-amino-2-oxo-1-phenylethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate |
|---|---|
| PubChem CID | 70455912 |
| Molecular Formula | C25H25ClN6O4S |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | benzyl 2-[3-(2-amino-2-oxo-1-phenylethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate |
| SMILES | C=C(CCl)C(C(=O)OCc1ccccc1)N1C(=O)C(C(C(N)=O)c2ccccc2)C1Sc1nnnn1C |
| InChI | InChI=1S/C25H25ClN6O4S/c1-15(13-26)20(24(35)36-14-16-9-5-3-6-10-16)32-22(34)19(23(32)37-25-28-29-30-31(25)2)18(21(27)33)17-11-7-4-8-12-17/h3-12,18-20,23H,1,13-14H2,2H3,(H2,27,33) |
| InChIKey | ALLGGIUOKVVLBV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|