C33H27BrCl2N4O8 — CID 88697135
(1,3-dioxoisoindol-2-yl)methyl 2-[3-[[2-(3-bromophenyl)-2-[formyl(phenylmethoxy)amino]acetyl]amino]-2-chloro-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate (PubChem CID 88697135) has the molecular formula C33H27BrCl2N4O8 and a molecular weight of 758.41 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-[3-[[2-(3-bromophenyl)-2-[formyl(phenylmethoxy)amino]acetyl]amino]-2-chloro-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-[3-[[2-(3-bromophenyl)-2-[formyl(phenylmethoxy)amino]acetyl]amino]-2-chloro-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate |
|---|---|
| PubChem CID | 88697135 |
| Molecular Formula | C33H27BrCl2N4O8 |
| Molecular Weight | 758.41 g/mol |
| Exact Mass | 756.04 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-[3-[[2-(3-bromophenyl)-2-[formyl(phenylmethoxy)amino]acetyl]amino]-2-chloro-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate |
| SMILES | C=C(CCl)C(C(=O)OCN1C(=O)c2ccccc2C1=O)N1C(=O)C(NC(=O)C(c2cccc(Br)c2)N(C=O)OCc2ccccc2)C1Cl |
| InChI | InChI=1S/C33H27BrCl2N4O8/c1-19(15-35)26(33(46)47-18-38-30(43)23-12-5-6-13-24(23)31(38)44)40-28(36)25(32(40)45)37-29(42)27(21-10-7-11-22(34)14-21)39(17-41)48-16-20-8-3-2-4-9-20/h2-14,17,25-28H,1,15-16,18H2,(H,37,42) |
| InChIKey | OFZYJMYRNRUQIH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|