C32H34BrN3O4 — CID 133228679
N-[(3-bromophenyl)methyl]-N-[1-(butan-2-ylamino)-1-oxo-3-phenylpropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 133228679) has the molecular formula C32H34BrN3O4 and a molecular weight of 604.55 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-[1-(butan-2-ylamino)-1-oxo-3-phenylpropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-[1-(butan-2-ylamino)-1-oxo-3-phenylpropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 133228679 |
| Molecular Formula | C32H34BrN3O4 |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-[1-(butan-2-ylamino)-1-oxo-3-phenylpropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H34BrN3O4/c1-3-22(2)34-30(38)28(20-23-11-5-4-6-12-23)36(21-24-13-9-14-25(33)19-24)29(37)17-10-18-35-31(39)26-15-7-8-16-27(26)32(35)40/h4-9,11-16,19,22,28H,3,10,17-18,20-21H2,1-2H3,(H,34,38) |
| InChIKey | JWNXHJMGWKTNLP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|