C26H24N4O6 — CID 88760272
benzyl 2-[1-acetyl-3-diazo-7-oxo-2-(2-phenylacetyl)-4-oxa-2,6-diazabicyclo[3.2.0]heptan-6-yl]-3-methylbut-2-enoate (PubChem CID 88760272) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is benzyl 2-[1-acetyl-3-diazo-7-oxo-2-(2-phenylacetyl)-4-oxa-2,6-diazabicyclo[3.2.0]heptan-6-yl]-3-methylbut-2-enoate.
| Compound Name | benzyl 2-[1-acetyl-3-diazo-7-oxo-2-(2-phenylacetyl)-4-oxa-2,6-diazabicyclo[3.2.0]heptan-6-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 88760272 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | benzyl 2-[1-acetyl-3-diazo-7-oxo-2-(2-phenylacetyl)-4-oxa-2,6-diazabicyclo[3.2.0]heptan-6-yl]-3-methylbut-2-enoate |
| SMILES | CC(=O)C12C(=O)N(C(C(=O)OCc3ccccc3)=C(C)C)C1OC(=[N+]=[N-])N2C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H24N4O6/c1-16(2)21(22(33)35-15-19-12-8-5-9-13-19)29-23(34)26(17(3)31)24(29)36-25(28-27)30(26)20(32)14-18-10-6-4-7-11-18/h4-13,24H,14-15H2,1-3H3 |
| InChIKey | NGWGPHIWXVAYFA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 129.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|