C19H18INO4 — CID 156678944
benzyl (2S,4S)-4-(iodomethyl)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 156678944) has the molecular formula C19H18INO4 and a molecular weight of 451.26 g/mol. Its IUPAC name is benzyl (2S,4S)-4-(iodomethyl)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (2S,4S)-4-(iodomethyl)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 156678944 |
| Molecular Formula | C19H18INO4 |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | benzyl (2S,4S)-4-(iodomethyl)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@]1(CI)C(=O)O[C@@H](c2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18INO4/c1-19(13-20)17(22)25-16(15-10-6-3-7-11-15)21(19)18(23)24-12-14-8-4-2-5-9-14/h2-11,16H,12-13H2,1H3/t16-,19+/m0/s1 |
| InChIKey | RMDXPXZFXYCXOT-QFBILLFUSA-N |
| XLogP | 4.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|