C12H12INO4 — CID 175451639
(2R)-4-(iodomethyl)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 175451639) has the molecular formula C12H12INO4 and a molecular weight of 361.14 g/mol. Its IUPAC name is (2R)-4-(iodomethyl)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylic acid.
| Compound Name | (2R)-4-(iodomethyl)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 175451639 |
| Molecular Formula | C12H12INO4 |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | (2R)-4-(iodomethyl)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | CC1(CI)C(=O)O[C@H](c2ccccc2)N1C(=O)O |
| InChI | InChI=1S/C12H12INO4/c1-12(7-13)10(15)18-9(14(12)11(16)17)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,16,17)/t9-,12?/m1/s1 |
| InChIKey | WEKFNEUEVIQHTO-PKEIRNPWSA-N |
| XLogP | 2.42 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|