C26H28N2O7 — CID 54128149
benzyl 2-[2-acetyloxy-3-methoxy-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 54128149) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is benzyl 2-[2-acetyloxy-3-methoxy-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzyl 2-[2-acetyloxy-3-methoxy-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 54128149 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | benzyl 2-[2-acetyloxy-3-methoxy-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | COC1(NC(=O)Cc2ccccc2)C(=O)N(C(C(=O)OCc2ccccc2)=C(C)C)C1OC(C)=O |
| InChI | InChI=1S/C26H28N2O7/c1-17(2)22(23(31)34-16-20-13-9-6-10-14-20)28-24(32)26(33-4,25(28)35-18(3)29)27-21(30)15-19-11-7-5-8-12-19/h5-14,25H,15-16H2,1-4H3,(H,27,30) |
| InChIKey | NSKXVEBANDSGEM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|