C25H35NO6Si — CID 164667841
benzyl N-[(3S,4aS,5R,8aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dioxo-4a,5,8,8a-tetrahydroisochromen-5-yl]carbamate (PubChem CID 164667841) has the molecular formula C25H35NO6Si and a molecular weight of 473.64 g/mol. Its IUPAC name is benzyl N-[(3S,4aS,5R,8aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dioxo-4a,5,8,8a-tetrahydroisochromen-5-yl]carbamate.
| Compound Name | benzyl N-[(3S,4aS,5R,8aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dioxo-4a,5,8,8a-tetrahydroisochromen-5-yl]carbamate |
|---|---|
| PubChem CID | 164667841 |
| Molecular Formula | C25H35NO6Si |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | benzyl N-[(3S,4aS,5R,8aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dioxo-4a,5,8,8a-tetrahydroisochromen-5-yl]carbamate |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(=O)[C@H]2CC=C[C@@H](NC(=O)OCc3ccccc3)[C@H]2C1=O |
| InChI | InChI=1S/C25H35NO6Si/c1-16(32-33(5,6)25(2,3)4)22-21(27)20-18(23(28)31-22)13-10-14-19(20)26-24(29)30-15-17-11-8-7-9-12-17/h7-12,14,16,18-20,22H,13,15H2,1-6H3,(H,26,29)/t16-,18-,19+,20-,22-/m0/s1 |
| InChIKey | QDIWVNXCBIEADX-UWQHEJLZSA-N |
| XLogP | 4.38 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|