C27H24N6O4 — CID 156762435
ethyl 1-[9-[(3-acetylphenyl)methyl]-6-phenylmethoxypurin-2-yl]pyrazole-4-carboxylate (PubChem CID 156762435) has the molecular formula C27H24N6O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is ethyl 1-[9-[(3-acetylphenyl)methyl]-6-phenylmethoxypurin-2-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[9-[(3-acetylphenyl)methyl]-6-phenylmethoxypurin-2-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 156762435 |
| Molecular Formula | C27H24N6O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | ethyl 1-[9-[(3-acetylphenyl)methyl]-6-phenylmethoxypurin-2-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc(OCc3ccccc3)c3ncn(Cc4cccc(C(C)=O)c4)c3n2)c1 |
| InChI | InChI=1S/C27H24N6O4/c1-3-36-26(35)22-13-29-33(15-22)27-30-24-23(25(31-27)37-16-19-8-5-4-6-9-19)28-17-32(24)14-20-10-7-11-21(12-20)18(2)34/h4-13,15,17H,3,14,16H2,1-2H3 |
| InChIKey | PTHKCNWDCQQWJX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |