C18H16N6O3 — CID 146507240
ethyl 1-(6-phenylmethoxy-7H-purin-2-yl)pyrazole-4-carboxylate (PubChem CID 146507240) has the molecular formula C18H16N6O3 and a molecular weight of 364.37 g/mol. Its IUPAC name is ethyl 1-(6-phenylmethoxy-7H-purin-2-yl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(6-phenylmethoxy-7H-purin-2-yl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 146507240 |
| Molecular Formula | C18H16N6O3 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl 1-(6-phenylmethoxy-7H-purin-2-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc(OCc3ccccc3)c3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C18H16N6O3/c1-2-26-17(25)13-8-21-24(9-13)18-22-15-14(19-11-20-15)16(23-18)27-10-12-6-4-3-5-7-12/h3-9,11H,2,10H2,1H3,(H,19,20,22,23) |
| InChIKey | VJYNGKQLRHJMGF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |