C26H24N6O3 — CID 157196005
ethyl 1-[7-[(4-methylphenyl)methyl]-6-phenylmethoxypurin-2-yl]pyrazole-4-carboxylate (PubChem CID 157196005) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is ethyl 1-[7-[(4-methylphenyl)methyl]-6-phenylmethoxypurin-2-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[7-[(4-methylphenyl)methyl]-6-phenylmethoxypurin-2-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 157196005 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | ethyl 1-[7-[(4-methylphenyl)methyl]-6-phenylmethoxypurin-2-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc(OCc3ccccc3)c3c(ncn3Cc3ccc(C)cc3)n2)c1 |
| InChI | InChI=1S/C26H24N6O3/c1-3-34-25(33)21-13-28-32(15-21)26-29-23-22(24(30-26)35-16-20-7-5-4-6-8-20)31(17-27-23)14-19-11-9-18(2)10-12-19/h4-13,15,17H,3,14,16H2,1-2H3 |
| InChIKey | AQGJGHFSCLLVRM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |