C37H48N6O5Si — CID 156762357
ethyl 1-[6-phenylmethoxy-7-[[4-[3-tri(propan-2-yl)silyloxypropoxy]phenyl]methyl]purin-2-yl]pyrazole-4-carboxylate (PubChem CID 156762357) has the molecular formula C37H48N6O5Si and a molecular weight of 684.91 g/mol. Its IUPAC name is ethyl 1-[6-phenylmethoxy-7-[[4-[3-tri(propan-2-yl)silyloxypropoxy]phenyl]methyl]purin-2-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[6-phenylmethoxy-7-[[4-[3-tri(propan-2-yl)silyloxypropoxy]phenyl]methyl]purin-2-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 156762357 |
| Molecular Formula | C37H48N6O5Si |
| Molecular Weight | 684.91 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | ethyl 1-[6-phenylmethoxy-7-[[4-[3-tri(propan-2-yl)silyloxypropoxy]phenyl]methyl]purin-2-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc(OCc3ccccc3)c3c(ncn3Cc3ccc(OCCCO[Si](C(C)C)(C(C)C)C(C)C)cc3)n2)c1 |
| InChI | InChI=1S/C37H48N6O5Si/c1-8-45-36(44)31-21-39-43(23-31)37-40-34-33(35(41-37)47-24-30-13-10-9-11-14-30)42(25-38-34)22-29-15-17-32(18-16-29)46-19-12-20-48-49(26(2)3,27(4)5)28(6)7/h9-11,13-18,21,23,25-28H,8,12,19-20,22,24H2,1-7H3 |
| InChIKey | VXHNBTMHBNBJIW-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.91 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|