C31H35N5O4Si — CID 157022877
ethyl 1-[5-[(3-phenylphenyl)methyl]-4-(2-trimethylsilylethoxymethoxy)pyrrolo[3,2-d]pyrimidin-2-yl]pyrazole-4-carboxylate (PubChem CID 157022877) has the molecular formula C31H35N5O4Si and a molecular weight of 569.74 g/mol. Its IUPAC name is ethyl 1-[5-[(3-phenylphenyl)methyl]-4-(2-trimethylsilylethoxymethoxy)pyrrolo[3,2-d]pyrimidin-2-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[5-[(3-phenylphenyl)methyl]-4-(2-trimethylsilylethoxymethoxy)pyrrolo[3,2-d]pyrimidin-2-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 157022877 |
| Molecular Formula | C31H35N5O4Si |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | ethyl 1-[5-[(3-phenylphenyl)methyl]-4-(2-trimethylsilylethoxymethoxy)pyrrolo[3,2-d]pyrimidin-2-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc(OCOCC[Si](C)(C)C)c3c(ccn3Cc3cccc(-c4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C31H35N5O4Si/c1-5-39-30(37)26-19-32-36(21-26)31-33-27-14-15-35(28(27)29(34-31)40-22-38-16-17-41(2,3)4)20-23-10-9-13-25(18-23)24-11-7-6-8-12-24/h6-15,18-19,21H,5,16-17,20,22H2,1-4H3 |
| InChIKey | LQERQHVUHUUYCV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 93.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|