C31H35N5O5Si — CID 157022897
ethyl 1-[5-[(3-phenoxyphenyl)methyl]-4-(2-trimethylsilylethoxymethoxy)pyrrolo[3,2-d]pyrimidin-2-yl]pyrazole-4-carboxylate (PubChem CID 157022897) has the molecular formula C31H35N5O5Si and a molecular weight of 585.74 g/mol. Its IUPAC name is ethyl 1-[5-[(3-phenoxyphenyl)methyl]-4-(2-trimethylsilylethoxymethoxy)pyrrolo[3,2-d]pyrimidin-2-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[5-[(3-phenoxyphenyl)methyl]-4-(2-trimethylsilylethoxymethoxy)pyrrolo[3,2-d]pyrimidin-2-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 157022897 |
| Molecular Formula | C31H35N5O5Si |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | ethyl 1-[5-[(3-phenoxyphenyl)methyl]-4-(2-trimethylsilylethoxymethoxy)pyrrolo[3,2-d]pyrimidin-2-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc(OCOCC[Si](C)(C)C)c3c(ccn3Cc3cccc(Oc4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C31H35N5O5Si/c1-5-39-30(37)24-19-32-36(21-24)31-33-27-14-15-35(28(27)29(34-31)40-22-38-16-17-42(2,3)4)20-23-10-9-13-26(18-23)41-25-11-7-6-8-12-25/h6-15,18-19,21H,5,16-17,20,22H2,1-4H3 |
| InChIKey | YUZNBVZDJJUSFE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 102.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|