C20H35N9O4S — CID 70293372
(2R)-5-(diaminomethylideneamino)-2-[[6-(dimethylamino)-8-methylsulfanyl-7-pentoxycarbonyl-8H-purin-9-yl]amino]pentanoic acid (PubChem CID 70293372) has the molecular formula C20H35N9O4S and a molecular weight of 497.63 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[[6-(dimethylamino)-8-methylsulfanyl-7-pentoxycarbonyl-8H-purin-9-yl]amino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[[6-(dimethylamino)-8-methylsulfanyl-7-pentoxycarbonyl-8H-purin-9-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70293372 |
| Molecular Formula | C20H35N9O4S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[[6-(dimethylamino)-8-methylsulfanyl-7-pentoxycarbonyl-8H-purin-9-yl]amino]pentanoic acid |
| SMILES | CCCCCOC(=O)N1c2c(N(C)C)ncnc2N(N[C@H](CCCN=C(N)N)C(=O)O)C1SC |
| InChI | InChI=1S/C20H35N9O4S/c1-5-6-7-11-33-20(32)28-14-15(27(2)3)24-12-25-16(14)29(19(28)34-4)26-13(17(30)31)9-8-10-23-18(21)22/h12-13,19,26H,5-11H2,1-4H3,(H,30,31)(H4,21,22,23)/t13-,19?/m1/s1 |
| InChIKey | XAUYPBFFKUXDDX-BSOCMFCZSA-N |
| XLogP | 1.15 |
| TPSA | 175.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|