C18H31N7O4 — CID 70292400
(2R)-5-amino-2-[[6-(dimethylamino)-7-pentoxycarbonyl-8H-purin-9-yl]amino]pentanoic acid (PubChem CID 70292400) has the molecular formula C18H31N7O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (2R)-5-amino-2-[[6-(dimethylamino)-7-pentoxycarbonyl-8H-purin-9-yl]amino]pentanoic acid.
| Compound Name | (2R)-5-amino-2-[[6-(dimethylamino)-7-pentoxycarbonyl-8H-purin-9-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70292400 |
| Molecular Formula | C18H31N7O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (2R)-5-amino-2-[[6-(dimethylamino)-7-pentoxycarbonyl-8H-purin-9-yl]amino]pentanoic acid |
| SMILES | CCCCCOC(=O)N1CN(N[C@H](CCCN)C(=O)O)c2ncnc(N(C)C)c21 |
| InChI | InChI=1S/C18H31N7O4/c1-4-5-6-10-29-18(28)24-12-25(22-13(17(26)27)8-7-9-19)16-14(24)15(23(2)3)20-11-21-16/h11,13,22H,4-10,12,19H2,1-3H3,(H,26,27)/t13-/m1/s1 |
| InChIKey | BIUYEMOSSAPRHH-CYBMUJFWSA-N |
| XLogP | 1.15 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|