(2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid

C10H23N3O2 — CID 88759035

IUPAC(2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid
SMILESCCCCCNN[C@@H](CCCN)C(=O)O
InChIInChI=1S/C10H23N3O2/c1-2-3-4-8-12-13-9(10(14)15)6-5-7-11/h9,12-13H,2-8,11H2,1H3,(H,14,15)/t9-/m0/s1
InChIKeyIXKQCHLQZQBVIH-VIFPVBQESA-N
MW217.31 g/mol
LogP0.46
Rot. Bonds10

About (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid

(2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid (PubChem CID 88759035) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid.

Molecular Properties

Compound Name(2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid
PubChem CID88759035
Molecular FormulaC10H23N3O2
Molecular Weight217.31 g/mol
Exact Mass217.18
IUPAC Name(2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid
SMILESCCCCCNN[C@@H](CCCN)C(=O)O
InChIInChI=1S/C10H23N3O2/c1-2-3-4-8-12-13-9(10(14)15)6-5-7-11/h9,12-13H,2-8,11H2,1H3,(H,14,15)/t9-/m0/s1
InChIKeyIXKQCHLQZQBVIH-VIFPVBQESA-N
XLogP0.46
TPSA87.38 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.31
LogP ≤ 50.46
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-6-amino-2-(2-butylhydrazinyl)hexanoic acid
CID 87447047
(2S)-2-[2-(3-carboxypropyl)hydrazinyl]hexanoic acid
CID 18638457
(2S)-6-amino-2-(octylamino)hexanoic acid
CID 88516426
6-amino-2-(hexylamino)hexanoic acid
CID 87424914
6-amino-2-(pentylamino)hexanoic acid;azane
CID 174768521
5-amino-2-methyl-N-pentylpentanamide
CID 104683456
(2S)-5-amino-2-(decanoylamino)pentanoic acid
CID 54420497
(2R)-5-amino-2-(ethylamino)pentanoic acid
CID 143752846
2-(dodecylamino)hexanoic acid
CID 139637216
2-(pentylamino)octanoic acid
CID 129188286
(2S)-2-hydrazinylheptanoic acid
CID 118266927
5-amino-2-(methylamino)pentanoic acid;hydrochloride
CID 23216389

Frequently Asked Questions

What is the IUPAC name of (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid?
The IUPAC name of (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid (CID 88759035) is (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid.
What is the SMILES notation for (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid?
The canonical SMILES for (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid is CCCCCNN[C@@H](CCCN)C(=O)O.
What is the InChIKey of (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid?
The InChIKey is IXKQCHLQZQBVIH-VIFPVBQESA-N. The full InChI is InChI=1S/C10H23N3O2/c1-2-3-4-8-12-13-9(10(14)15)6-5-7-11/h9,12-13H,2-8,11H2,1H3,(H,14,15)/t9-/m0/s1.
What are the key properties of (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid?
(2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid has a molecular weight of 217.31 g/mol, XLogP of 0.46, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-amino-2-(2-pentylhydrazinyl)pentanoic acid is sourced from PubChem (CID 88759035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).