C16H31N5O9 — CID 89081213
5-[[amino-[4-(dihydroxyamino)oxybutoxycarbonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 89081213) has the molecular formula C16H31N5O9 and a molecular weight of 437.45 g/mol. Its IUPAC name is 5-[[amino-[4-(dihydroxyamino)oxybutoxycarbonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | 5-[[amino-[4-(dihydroxyamino)oxybutoxycarbonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 89081213 |
| Molecular Formula | C16H31N5O9 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 5-[[amino-[4-(dihydroxyamino)oxybutoxycarbonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCC/N=C(\N)NC(=O)OCCCCON(O)O)C(=O)O |
| InChI | InChI=1S/C16H31N5O9/c1-16(2,3)30-15(25)19-11(12(22)23)7-6-8-18-13(17)20-14(24)28-9-4-5-10-29-21(26)27/h11,26-27H,4-10H2,1-3H3,(H,19,25)(H,22,23)(H3,17,18,20,24) |
| InChIKey | LEBHUMKXNRFSLH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 205.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|