C12H25N3O6 — CID 89081486
6-amino-2-[6-(dihydroxyamino)oxyhexanoylamino]hexanoic acid (PubChem CID 89081486) has the molecular formula C12H25N3O6 and a molecular weight of 307.35 g/mol. Its IUPAC name is 6-amino-2-[6-(dihydroxyamino)oxyhexanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[6-(dihydroxyamino)oxyhexanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 89081486 |
| Molecular Formula | C12H25N3O6 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 6-amino-2-[6-(dihydroxyamino)oxyhexanoylamino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CCCCCON(O)O)C(=O)O |
| InChI | InChI=1S/C12H25N3O6/c13-8-4-3-6-10(12(17)18)14-11(16)7-2-1-5-9-21-15(19)20/h10,19-20H,1-9,13H2,(H,14,16)(H,17,18) |
| InChIKey | OUNGAZHLVKOKSX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|