C10H18O6S — CID 87267507
(2R)-3-[2-(2-methoxyethoxy)ethoxycarbonylsulfanyl]-2-methylpropanoic acid (PubChem CID 87267507) has the molecular formula C10H18O6S and a molecular weight of 266.31 g/mol. Its IUPAC name is (2R)-3-[2-(2-methoxyethoxy)ethoxycarbonylsulfanyl]-2-methylpropanoic acid.
| Compound Name | (2R)-3-[2-(2-methoxyethoxy)ethoxycarbonylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87267507 |
| Molecular Formula | C10H18O6S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (2R)-3-[2-(2-methoxyethoxy)ethoxycarbonylsulfanyl]-2-methylpropanoic acid |
| SMILES | COCCOCCOC(=O)SC[C@H](C)C(=O)O |
| InChI | InChI=1S/C10H18O6S/c1-8(9(11)12)7-17-10(13)16-6-5-15-4-3-14-2/h8H,3-7H2,1-2H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | MKKPAENZQSVHAS-QMMMGPOBSA-N |
| XLogP | 1.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|